Products 1256346-02-7

CAS 1256346-02-7 is the registry number for 3-Propoxy-5-(trifluoromethoxy)phenylboronic acid, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 1g.

Structural formula: {0} (CAS {1})

[3-propoxy-5-(trifluoromethoxy)phenyl]boronic acid (CAS 1256346-02-7) is a chemical compound with the molecular formula C10H12BF3O4 and a molecular weight of 264.01 g/mol. IUPAC name: [3-propoxy-5-(trifluoromethoxy)phenyl]boronic acid. InChIKey: CGLDYQGCSJGHME-UHFFFAOYSA-N.

Identity
Molecular formulaC10H12BF3O4
Molecular weight264.01 g/mol
IUPAC name[3-propoxy-5-(trifluoromethoxy)phenyl]boronic acid
InChIKeyCGLDYQGCSJGHME-UHFFFAOYSA-N
SMILESB(C1=CC(=CC(=C1)OC(F)(F)F)OCCC)(O)O

Computed by PubChem (NCBI)