CAS 1333313-17-9 appears in our catalog under these names: (2-Isopropoxy-5-(trifluoromethoxy)phenyl)boronic acid, 97%, (2-Isopropoxy-5-(trifluoromethoxy)phenyl)boronic acid, 97%, 97%, (2-Isopropoxy-5-(trifluoromethoxy)phenyl)boronic acid, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 100mg, 5g, 250mg, 500mg, 1g.
[2-propan-2-yloxy-5-(trifluoromethoxy)phenyl]boronic acid (CAS 1333313-17-9) is a chemical compound with the molecular formula C10H12BF3O4 and a molecular weight of 264.01 g/mol. IUPAC name: [2-propan-2-yloxy-5-(trifluoromethoxy)phenyl]boronic acid. InChIKey: PJWXIRIEFGTCOH-UHFFFAOYSA-N.
| Molecular formula | C10H12BF3O4 |
|---|---|
| Molecular weight | 264.01 g/mol |
| IUPAC name | [2-propan-2-yloxy-5-(trifluoromethoxy)phenyl]boronic acid |
| InChIKey | PJWXIRIEFGTCOH-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)OC(F)(F)F)OC(C)C)(O)O |
Computed by PubChem (NCBI)