Products 2096333-63-8

CAS 2096333-63-8 is the registry number for 3-Propoxy-4-(trifluoromethoxy)phenylboronic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 10g.

Structural formula: {0} (CAS {1})

[3-propoxy-4-(trifluoromethoxy)phenyl]boronic acid (CAS 2096333-63-8) is a chemical compound with the molecular formula C10H12BF3O4 and a molecular weight of 264.01 g/mol. IUPAC name: [3-propoxy-4-(trifluoromethoxy)phenyl]boronic acid. InChIKey: PRZBWPNYGNZDDJ-UHFFFAOYSA-N.

Identity
Molecular formulaC10H12BF3O4
Molecular weight264.01 g/mol
IUPAC name[3-propoxy-4-(trifluoromethoxy)phenyl]boronic acid
InChIKeyPRZBWPNYGNZDDJ-UHFFFAOYSA-N
SMILESB(C1=CC(=C(C=C1)OC(F)(F)F)OCCC)(O)O

Computed by PubChem (NCBI)