CAS 2096333-63-8 is the registry number for 3-Propoxy-4-(trifluoromethoxy)phenylboronic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 10g.
[3-propoxy-4-(trifluoromethoxy)phenyl]boronic acid (CAS 2096333-63-8) is a chemical compound with the molecular formula C10H12BF3O4 and a molecular weight of 264.01 g/mol. IUPAC name: [3-propoxy-4-(trifluoromethoxy)phenyl]boronic acid. InChIKey: PRZBWPNYGNZDDJ-UHFFFAOYSA-N.
| Molecular formula | C10H12BF3O4 |
|---|---|
| Molecular weight | 264.01 g/mol |
| IUPAC name | [3-propoxy-4-(trifluoromethoxy)phenyl]boronic acid |
| InChIKey | PRZBWPNYGNZDDJ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)OC(F)(F)F)OCCC)(O)O |
Computed by PubChem (NCBI)