Products 1256354-89-8

CAS 1256354-89-8 is the registry number for 2,4-Dichloro-5-(2-methoxyethoxy)phenylboronic acid, 96%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 100mg.

Structural formula: {0} (CAS {1})

[2,4-dichloro-5-(2-methoxyethoxy)phenyl]boronic acid (CAS 1256354-89-8) is a chemical compound with the molecular formula C9H11BCl2O4 and a molecular weight of 264.90 g/mol. IUPAC name: [2,4-dichloro-5-(2-methoxyethoxy)phenyl]boronic acid. InChIKey: RNOGFSLJRIPEMF-UHFFFAOYSA-N.

Identity
Molecular formulaC9H11BCl2O4
Molecular weight264.90 g/mol
IUPAC name[2,4-dichloro-5-(2-methoxyethoxy)phenyl]boronic acid
InChIKeyRNOGFSLJRIPEMF-UHFFFAOYSA-N
SMILESB(C1=CC(=C(C=C1Cl)Cl)OCCOC)(O)O

Computed by PubChem (NCBI)