CAS 1256354-99-0 is the registry number for 4,5-Dichloro-2-(2-methoxyethoxy)phenylboronic acid, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
[4,5-dichloro-2-(2-methoxyethoxy)phenyl]boronic acid (CAS 1256354-99-0) is a chemical compound with the molecular formula C9H11BCl2O4 and a molecular weight of 264.90 g/mol. IUPAC name: [4,5-dichloro-2-(2-methoxyethoxy)phenyl]boronic acid. InChIKey: VPTJSQLBVWGXSY-UHFFFAOYSA-N.
| Molecular formula | C9H11BCl2O4 |
|---|---|
| Molecular weight | 264.90 g/mol |
| IUPAC name | [4,5-dichloro-2-(2-methoxyethoxy)phenyl]boronic acid |
| InChIKey | VPTJSQLBVWGXSY-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1OCCOC)Cl)Cl)(O)O |
Computed by PubChem (NCBI)