CAS 2377606-24-9 appears in our catalog under these names: 2,3-Dichloro-4-(dimethoxymethyl)phenylboronic acid, 96%, (2,3-Dichloro-4-(dimethoxymethyl)phenyl)boronic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
[2,3-dichloro-4-(dimethoxymethyl)phenyl]boronic acid (CAS 2377606-24-9) is a chemical compound with the molecular formula C9H11BCl2O4 and a molecular weight of 264.90 g/mol. IUPAC name: [2,3-dichloro-4-(dimethoxymethyl)phenyl]boronic acid. InChIKey: RSFWGOSGFOXJIJ-UHFFFAOYSA-N.
| Molecular formula | C9H11BCl2O4 |
|---|---|
| Molecular weight | 264.90 g/mol |
| IUPAC name | [2,3-dichloro-4-(dimethoxymethyl)phenyl]boronic acid |
| InChIKey | RSFWGOSGFOXJIJ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)C(OC)OC)Cl)Cl)(O)O |
Computed by PubChem (NCBI)