Products 2377606-24-9

CAS 2377606-24-9 appears in our catalog under these names: 2,3-Dichloro-4-(dimethoxymethyl)phenylboronic acid, 96%, (2,3-Dichloro-4-(dimethoxymethyl)phenyl)boronic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

[2,3-dichloro-4-(dimethoxymethyl)phenyl]boronic acid (CAS 2377606-24-9) is a chemical compound with the molecular formula C9H11BCl2O4 and a molecular weight of 264.90 g/mol. IUPAC name: [2,3-dichloro-4-(dimethoxymethyl)phenyl]boronic acid. InChIKey: RSFWGOSGFOXJIJ-UHFFFAOYSA-N.

Identity
Molecular formulaC9H11BCl2O4
Molecular weight264.90 g/mol
IUPAC name[2,3-dichloro-4-(dimethoxymethyl)phenyl]boronic acid
InChIKeyRSFWGOSGFOXJIJ-UHFFFAOYSA-N
SMILESB(C1=C(C(=C(C=C1)C(OC)OC)Cl)Cl)(O)O

Computed by PubChem (NCBI)