CAS 1256354-97-8 appears in our catalog under these names: 4-Chloro-2-(2-methoxyethoxy)phenylboronic acid, 96%, (4-Chloro-2-(2-methoxyethoxy)phenyl)boronic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg, 100mg.
[4-chloro-2-(2-methoxyethoxy)phenyl]boronic acid (CAS 1256354-97-8) is a chemical compound with the molecular formula C9H12BClO4 and a molecular weight of 230.45 g/mol. IUPAC name: [4-chloro-2-(2-methoxyethoxy)phenyl]boronic acid. InChIKey: CLYQTKHBUWZDKT-UHFFFAOYSA-N.
| Molecular formula | C9H12BClO4 |
|---|---|
| Molecular weight | 230.45 g/mol |
| IUPAC name | [4-chloro-2-(2-methoxyethoxy)phenyl]boronic acid |
| InChIKey | CLYQTKHBUWZDKT-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)Cl)OCCOC)(O)O |
Computed by PubChem (NCBI)