Products 2096338-67-7
CAS 2096338-67-7 appears in our catalog under these names: 3-Chloro-5-ethoxy-4-methoxyphenylboronic acid, 97%, (3-Chloro-5-ethoxy-4-methoxyphenyl)boronic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 25g, 1g.
(3-chloro-5-ethoxy-4-methoxyphenyl)boronic acid (CAS 2096338-67-7) is a chemical compound with the molecular formula C9H12BClO4 and a molecular weight of 230.45 g/mol. IUPAC name: (3-chloro-5-ethoxy-4-methoxyphenyl)boronic acid. InChIKey: MHNQJVJDELKQEE-UHFFFAOYSA-N.
| Molecular formula | C9H12BClO4 |
|---|---|
| Molecular weight | 230.45 g/mol |
| IUPAC name | (3-chloro-5-ethoxy-4-methoxyphenyl)boronic acid |
| InChIKey | MHNQJVJDELKQEE-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)Cl)OC)OCC)(O)O |
Computed by PubChem (NCBI)