Products 2096339-83-0

CAS 2096339-83-0 is the registry number for 2-Chloro-5-(2-methoxyethoxy)phenylboronic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 25g, 1g.

Structural formula: {0} (CAS {1})

[2-chloro-5-(2-methoxyethoxy)phenyl]boronic acid (CAS 2096339-83-0) is a chemical compound with the molecular formula C9H12BClO4 and a molecular weight of 230.45 g/mol. IUPAC name: [2-chloro-5-(2-methoxyethoxy)phenyl]boronic acid. InChIKey: AZQWPQOLXQQDTB-UHFFFAOYSA-N.

Identity
Molecular formulaC9H12BClO4
Molecular weight230.45 g/mol
IUPAC name[2-chloro-5-(2-methoxyethoxy)phenyl]boronic acid
InChIKeyAZQWPQOLXQQDTB-UHFFFAOYSA-N
SMILESB(C1=C(C=CC(=C1)OCCOC)Cl)(O)O

Computed by PubChem (NCBI)