Products 1256355-18-6
CAS 1256355-18-6 appears in our catalog under these names: 6-(Dimethoxymethyl)pyridin-2-ylboronic acid, 96%, (6-(Dimethoxymethyl)pyridin-2-yl)boronic acid, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 1g, 250mg.
[6-(dimethoxymethyl)-2-pyridinyl]boronic acid (CAS 1256355-18-6) is a chemical compound with the molecular formula C8H12BNO4 and a molecular weight of 197.00 g/mol. IUPAC name: [6-(dimethoxymethyl)-2-pyridinyl]boronic acid. InChIKey: KOOILEZKMARTEI-UHFFFAOYSA-N.
| Molecular formula | C8H12BNO4 |
|---|---|
| Molecular weight | 197.00 g/mol |
| IUPAC name | [6-(dimethoxymethyl)-2-pyridinyl]boronic acid |
| InChIKey | KOOILEZKMARTEI-UHFFFAOYSA-N |
| SMILES | B(C1=NC(=CC=C1)C(OC)OC)(O)O |
Computed by PubChem (NCBI)