Products 2121514-98-3
CAS 2121514-98-3 appears in our catalog under these names: 2,6-Dimethoxy-5-methylpyridine-3-boronic acid, 2,6-Dimethoxy-5-methylpyridine-3-boronic acid, 95%, (2,6-Dimethoxy-5-methylpyridin-3-yl)boronic acid, 98%. Offered by: Fluorochem, Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 10g, 250mg.
(2,6-dimethoxy-5-methyl-3-pyridinyl)boronic acid (CAS 2121514-98-3) is a chemical compound with the molecular formula C8H12BNO4 and a molecular weight of 197.00 g/mol. IUPAC name: (2,6-dimethoxy-5-methyl-3-pyridinyl)boronic acid. InChIKey: UWFFAOLMNDPOIN-UHFFFAOYSA-N.
| Molecular formula | C8H12BNO4 |
|---|---|
| Molecular weight | 197.00 g/mol |
| IUPAC name | (2,6-dimethoxy-5-methyl-3-pyridinyl)boronic acid |
| InChIKey | UWFFAOLMNDPOIN-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(N=C1OC)OC)C)(O)O |
Computed by PubChem (NCBI)