CAS 1639342-43-0 is the registry number for (T-4)-(N-((Carboxy-κO)methyl)-N-methylglycinato(2-)-κN,κO)-2-propen-1-ylboron. Offered by: TRC. Available pack sizes: 100mg.
6-methyl-2-prop-2-enyl-1,3,6,2-dioxazaborocane-4,8-dione (CAS 1639342-43-0) is a chemical compound with the molecular formula C8H12BNO4 and a molecular weight of 197.00 g/mol. IUPAC name: 6-methyl-2-prop-2-enyl-1,3,6,2-dioxazaborocane-4,8-dione. InChIKey: RKMASTMFHKLQNL-UHFFFAOYSA-N.
| Molecular formula | C8H12BNO4 |
|---|---|
| Molecular weight | 197.00 g/mol |
| IUPAC name | 6-methyl-2-prop-2-enyl-1,3,6,2-dioxazaborocane-4,8-dione |
| InChIKey | RKMASTMFHKLQNL-UHFFFAOYSA-N |
| SMILES | B1(OC(=O)CN(CC(=O)O1)C)CC=C |
Computed by PubChem (NCBI)