Products 1256355-39-1

CAS 1256355-39-1 is the registry number for 4-Bromopyridine-3-boronic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g, 100mg.

Structural formula: {0} (CAS {1})

(4-bromo-3-pyridinyl)boronic acid (CAS 1256355-39-1) is a chemical compound with the molecular formula C5H5BBrNO2 and a molecular weight of 201.82 g/mol. IUPAC name: (4-bromo-3-pyridinyl)boronic acid. InChIKey: OEQUZDNRPMTXMQ-UHFFFAOYSA-N.

Identity
Molecular formulaC5H5BBrNO2
Molecular weight201.82 g/mol
IUPAC name(4-bromo-3-pyridinyl)boronic acid
InChIKeyOEQUZDNRPMTXMQ-UHFFFAOYSA-N
SMILESB(C1=C(C=CN=C1)Br)(O)O

Computed by PubChem (NCBI)