Products 452972-08-6

CAS 452972-08-6 appears in our catalog under these names: 2-Bromopyridine-3-boronic acid, 98%, 2–Bromopyridine–3–boronic acid(contains varying amounts of Anhydride), 2-Bromopyridine-3-boronic Acid (contains varying amounts of Anhydride), (2-Bromopyridin-3-yl)boronic acid 97%, (2-Bromopyridin-3-yl)boronic acid, 97%, 97%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 5g, 25g, 100g, 1g, 250mg, 500g, 50g, 10g.

Structural formula: {0} (CAS {1})

(2-bromo-3-pyridinyl)boronic acid (CAS 452972-08-6) is a chemical compound with the molecular formula C5H5BBrNO2 and a molecular weight of 201.82 g/mol. IUPAC name: (2-bromo-3-pyridinyl)boronic acid. InChIKey: ODWRFKJNUJLAHM-UHFFFAOYSA-N.

Identity
Molecular formulaC5H5BBrNO2
Molecular weight201.82 g/mol
IUPAC name(2-bromo-3-pyridinyl)boronic acid
InChIKeyODWRFKJNUJLAHM-UHFFFAOYSA-N
SMILESB(C1=C(N=CC=C1)Br)(O)O

Computed by PubChem (NCBI)