Products 223463-14-7

CAS 223463-14-7 appears in our catalog under these names: BPBA, 6-Bromopyridine-3-boronic acid/ 95+%, 2-Bromopyridine-5-boronic Acid (contains varying amounts of Anhydride), BPBA 98%, 6-BROMO-3-PYRIDINYLBORONIC ACID, >=95%. Offered by: TargetMol, Chemat, GLPBio, TCI, Ambeed. Available pack sizes: 500mg, 1g, 5g, 250mg, 10g, 25g, 100g, 500g.

Structural formula: {0} (CAS {1})

(6-bromo-3-pyridinyl)boronic acid (CAS 223463-14-7) is a chemical compound with the molecular formula C5H5BBrNO2 and a molecular weight of 201.82 g/mol. IUPAC name: (6-bromo-3-pyridinyl)boronic acid. InChIKey: BCYWDUVHAPHGIP-UHFFFAOYSA-N.

Identity
Molecular formulaC5H5BBrNO2
Molecular weight201.82 g/mol
IUPAC name(6-bromo-3-pyridinyl)boronic acid
InChIKeyBCYWDUVHAPHGIP-UHFFFAOYSA-N
SMILESB(C1=CN=C(C=C1)Br)(O)O

Computed by PubChem (NCBI)