Products 1256358-70-9
CAS 1256358-70-9 appears in our catalog under these names: 3-(4-chlorophenoxymethyl)phenylboronic acid, 97%, (3-((4-Chlorophenoxy)methyl)phenyl)boronic acid, 98%, (3-((4-Chlorophenoxy)methyl)phenyl)boronic acid, 95%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 1g, 5g.
[3-[(4-chlorophenoxy)methyl]phenyl]boronic acid (CAS 1256358-70-9) is a chemical compound with the molecular formula C13H12BClO3 and a molecular weight of 262.50 g/mol. IUPAC name: [3-[(4-chlorophenoxy)methyl]phenyl]boronic acid. InChIKey: PCSYEFAEONRRRW-UHFFFAOYSA-N.
| Molecular formula | C13H12BClO3 |
|---|---|
| Molecular weight | 262.50 g/mol |
| IUPAC name | [3-[(4-chlorophenoxy)methyl]phenyl]boronic acid |
| InChIKey | PCSYEFAEONRRRW-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)COC2=CC=C(C=C2)Cl)(O)O |
Computed by PubChem (NCBI)