CAS 1256358-85-6 appears in our catalog under these names: 3'-(Methoxycarbonyl)biphenyl-4-boronic acid pinacol ester, 96%, 96%, Methyl 4'-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-[1,1'-biphenyl]-3-carboxylate, 96%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
Methyl 3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]benzoate (CAS 1256358-85-6) is a chemical compound with the molecular formula C20H23BO4 and a molecular weight of 338.2 g/mol. IUPAC name: methyl 3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]benzoate. InChIKey: WHJJVEIJHJEWDK-UHFFFAOYSA-N.
| Molecular formula | C20H23BO4 |
|---|---|
| Molecular weight | 338.2 g/mol |
| IUPAC name | methyl 3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]benzoate |
| InChIKey | WHJJVEIJHJEWDK-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C3=CC(=CC=C3)C(=O)OC |
Computed by PubChem (NCBI)