CAS 2490665-98-8 appears in our catalog under these names: 4-[4-(Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl acetate, 95%, 4'-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-(1,1'-biphenyl)-4-yl acetate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl] acetate (CAS 2490665-98-8) is a chemical compound with the molecular formula C20H23BO4 and a molecular weight of 338.2 g/mol. IUPAC name: [4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl] acetate. InChIKey: SXYZYQOGUGGWKZ-UHFFFAOYSA-N.
| Molecular formula | C20H23BO4 |
|---|---|
| Molecular weight | 338.2 g/mol |
| IUPAC name | [4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl] acetate |
| InChIKey | SXYZYQOGUGGWKZ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C3=CC=C(C=C3)OC(=O)C |
Computed by PubChem (NCBI)