CAS 880157-10-8 is the registry number for 3-(-4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid benzyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Benzyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (CAS 880157-10-8) is a chemical compound with the molecular formula C20H23BO4 and a molecular weight of 338.2 g/mol. IUPAC name: benzyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate. InChIKey: NFOUTNGHWQTMQA-UHFFFAOYSA-N.
| Molecular formula | C20H23BO4 |
|---|---|
| Molecular weight | 338.2 g/mol |
| IUPAC name | benzyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
| InChIKey | NFOUTNGHWQTMQA-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)C(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)