Products 880157-10-8

CAS 880157-10-8 is the registry number for 3-(-4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid benzyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Benzyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (CAS 880157-10-8) is a chemical compound with the molecular formula C20H23BO4 and a molecular weight of 338.2 g/mol. IUPAC name: benzyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate. InChIKey: NFOUTNGHWQTMQA-UHFFFAOYSA-N.

Identity
Molecular formulaC20H23BO4
Molecular weight338.2 g/mol
IUPAC namebenzyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate
InChIKeyNFOUTNGHWQTMQA-UHFFFAOYSA-N
SMILESB1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)C(=O)OCC3=CC=CC=C3

Computed by PubChem (NCBI)