CAS 1256359-01-9 appears in our catalog under these names: 4-(2-Chloroethoxy)phenylboronic acid, pinacol ester, 95%, 2-(4-(2-Chloroethoxy)phenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2-[4-(2-chloroethoxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1256359-01-9) is a chemical compound with the molecular formula C14H20BClO3 and a molecular weight of 282.57 g/mol. IUPAC name: 2-[4-(2-chloroethoxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: CRKJOEYJQACAKT-UHFFFAOYSA-N.
| Molecular formula | C14H20BClO3 |
|---|---|
| Molecular weight | 282.57 g/mol |
| IUPAC name | 2-[4-(2-chloroethoxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | CRKJOEYJQACAKT-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)OCCCl |
Computed by PubChem (NCBI)