Products 2121514-37-0
CAS 2121514-37-0 appears in our catalog under these names: 2-(3-Chloro-2-ethoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95%, 2-(3-Chloro-2-ethoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 10g, 5g, 25g, 250mg, 1g.
2-(3-chloro-2-ethoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2121514-37-0) is a chemical compound with the molecular formula C14H20BClO3 and a molecular weight of 282.57 g/mol. IUPAC name: 2-(3-chloro-2-ethoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: DULKVCRGMBGMFU-UHFFFAOYSA-N.
| Molecular formula | C14H20BClO3 |
|---|---|
| Molecular weight | 282.57 g/mol |
| IUPAC name | 2-(3-chloro-2-ethoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | DULKVCRGMBGMFU-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C(=CC=C2)Cl)OCC |
Computed by PubChem (NCBI)