CAS 1689512-53-5 appears in our catalog under these names: 5-Chloro-2-ethoxyphenylboronic acid pinacol ester, 5-Chloro-2-ethoxyphenylboronic acid pinacol ester, 97%, 2-(5-Chloro-2-ethoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%. Offered by: Fluorochem, Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 100g, 25g, 1g.
2-(5-chloro-2-ethoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1689512-53-5) is a chemical compound with the molecular formula C14H20BClO3 and a molecular weight of 282.57 g/mol. IUPAC name: 2-(5-chloro-2-ethoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: DANJRWPYEIUCPA-UHFFFAOYSA-N.
| Molecular formula | C14H20BClO3 |
|---|---|
| Molecular weight | 282.57 g/mol |
| IUPAC name | 2-(5-chloro-2-ethoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | DANJRWPYEIUCPA-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)Cl)OCC |
Computed by PubChem (NCBI)