CAS 1256359-92-8 is the registry number for (2-Cyanomethoxy)-4-methoxyphenylboronic acid, pinacol ester, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-[5-methoxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]acetonitrile (CAS 1256359-92-8) is a chemical compound with the molecular formula C15H20BNO4 and a molecular weight of 289.14 g/mol. IUPAC name: 2-[5-methoxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]acetonitrile. InChIKey: DMOOJGXHWRDFCS-UHFFFAOYSA-N.
| Molecular formula | C15H20BNO4 |
|---|---|
| Molecular weight | 289.14 g/mol |
| IUPAC name | 2-[5-methoxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]acetonitrile |
| InChIKey | DMOOJGXHWRDFCS-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)OC)OCC#N |
Computed by PubChem (NCBI)