CAS 1352399-80-4 is the registry number for 3-Formyl-N-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-formyl-N-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide (CAS 1352399-80-4) is a chemical compound with the molecular formula C15H20BNO4 and a molecular weight of 289.14 g/mol. IUPAC name: 3-formyl-N-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide. InChIKey: HTVMZJKMDCKCRS-UHFFFAOYSA-N.
| Molecular formula | C15H20BNO4 |
|---|---|
| Molecular weight | 289.14 g/mol |
| IUPAC name | 3-formyl-N-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide |
| InChIKey | HTVMZJKMDCKCRS-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2)C(=O)NC)C=O |
Computed by PubChem (NCBI)