Products 1858215-72-1
CAS 1858215-72-1 is the registry number for 3-Ethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzo[d]oxazol-2(3H)-one, 97%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
3-ethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzoxazol-2-one (CAS 1858215-72-1) is a chemical compound with the molecular formula C15H20BNO4 and a molecular weight of 289.14 g/mol. IUPAC name: 3-ethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzoxazol-2-one. InChIKey: UAAJAHKTTMDIER-UHFFFAOYSA-N.
| Molecular formula | C15H20BNO4 |
|---|---|
| Molecular weight | 289.14 g/mol |
| IUPAC name | 3-ethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzoxazol-2-one |
| InChIKey | UAAJAHKTTMDIER-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=C2)N(C(=O)O3)CC |
Computed by PubChem (NCBI)