CAS 1256482-68-4 appears in our catalog under these names: 6-Chloro-2-fluoro-3-methoxy-dl-phenylalanine, 95%, 2-Amino-3-(6-chloro-2-fluoro-3-methoxyphenyl)propanoic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g, 10g, 25g.
2-amino-3-(6-chloro-2-fluoro-3-methoxyphenyl)propanoic acid (CAS 1256482-68-4) is a chemical compound with the molecular formula C10H11ClFNO3 and a molecular weight of 247.65 g/mol. IUPAC name: 2-amino-3-(6-chloro-2-fluoro-3-methoxyphenyl)propanoic acid. InChIKey: VWUCVGXVDGKDBN-UHFFFAOYSA-N.
| Molecular formula | C10H11ClFNO3 |
|---|---|
| Molecular weight | 247.65 g/mol |
| IUPAC name | 2-amino-3-(6-chloro-2-fluoro-3-methoxyphenyl)propanoic acid |
| InChIKey | VWUCVGXVDGKDBN-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)Cl)CC(C(=O)O)N)F |
Computed by PubChem (NCBI)