CAS 1909320-14-4 is the registry number for Methyl 7-fluoro-3,4-dihydro-2H-1,4-benzoxazine-2-carboxylate hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Methyl 7-fluoro-3,4-dihydro-2H-1,4-benzoxazine-2-carboxylate;hydrochloride (CAS 1909320-14-4) is a chemical compound with the molecular formula C10H11ClFNO3 and a molecular weight of 247.65 g/mol. IUPAC name: methyl 7-fluoro-3,4-dihydro-2H-1,4-benzoxazine-2-carboxylate;hydrochloride. InChIKey: OVCXYYXFEHWMLI-UHFFFAOYSA-N.
| Molecular formula | C10H11ClFNO3 |
|---|---|
| Molecular weight | 247.65 g/mol |
| IUPAC name | methyl 7-fluoro-3,4-dihydro-2H-1,4-benzoxazine-2-carboxylate;hydrochloride |
| InChIKey | OVCXYYXFEHWMLI-UHFFFAOYSA-N |
| SMILES | COC(=O)C1CNC2=C(O1)C=C(C=C2)F.Cl |
Computed by PubChem (NCBI)