CAS 1706418-83-8 appears in our catalog under these names: 4-Chloro-2-fluoro-3-methoxy-dl-phenylalanine, 95%, 2-Amino-3-(4-chloro-2-fluoro-3-methoxyphenyl)propanoic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
2-amino-3-(4-chloro-2-fluoro-3-methoxyphenyl)propanoic acid (CAS 1706418-83-8) is a chemical compound with the molecular formula C10H11ClFNO3 and a molecular weight of 247.65 g/mol. IUPAC name: 2-amino-3-(4-chloro-2-fluoro-3-methoxyphenyl)propanoic acid. InChIKey: PVFWDJBNASYQGK-UHFFFAOYSA-N.
| Molecular formula | C10H11ClFNO3 |
|---|---|
| Molecular weight | 247.65 g/mol |
| IUPAC name | 2-amino-3-(4-chloro-2-fluoro-3-methoxyphenyl)propanoic acid |
| InChIKey | PVFWDJBNASYQGK-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1F)CC(C(=O)O)N)Cl |
Computed by PubChem (NCBI)