Products 1256502-68-7

CAS 1256502-68-7 is the registry number for 4-(Dimethylamino)-2-fluorobenzoic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

4-(dimethylamino)-2-fluorobenzoic acid (CAS 1256502-68-7) is a chemical compound with the molecular formula C9H10FNO2 and a molecular weight of 183.18 g/mol. IUPAC name: 4-(dimethylamino)-2-fluorobenzoic acid. InChIKey: KJGTURFYFFKUDK-UHFFFAOYSA-N.

Identity
Molecular formulaC9H10FNO2
Molecular weight183.18 g/mol
IUPAC name4-(dimethylamino)-2-fluorobenzoic acid
InChIKeyKJGTURFYFFKUDK-UHFFFAOYSA-N
SMILESCN(C)C1=CC(=C(C=C1)C(=O)O)F

Computed by PubChem (NCBI)