Products 1256544-85-0

CAS 1256544-85-0 is the registry number for Naphtho[2,3-b]benzofuran-6-ylboronic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Naphtho[2,3-b][1]benzofuran-6-ylboronic acid (CAS 1256544-85-0) is a chemical compound with the molecular formula C16H11BO3 and a molecular weight of 262.1 g/mol. IUPAC name: naphtho[2,3-b][1]benzofuran-6-ylboronic acid. InChIKey: IBKOIXLIUKPRSD-UHFFFAOYSA-N.

Identity
Molecular formulaC16H11BO3
Molecular weight262.1 g/mol
IUPAC namenaphtho[2,3-b][1]benzofuran-6-ylboronic acid
InChIKeyIBKOIXLIUKPRSD-UHFFFAOYSA-N
SMILESB(C1=C2C(=CC3=CC=CC=C13)C4=CC=CC=C4O2)(O)O

Computed by PubChem (NCBI)