Products 2261008-21-1
CAS 2261008-21-1 is the registry number for Naphtho[2,3-b]benzofuran-1-ylboronic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
Naphtho[2,3-b][1]benzofuran-1-ylboronic acid (CAS 2261008-21-1) is a chemical compound with the molecular formula C16H11BO3 and a molecular weight of 262.1 g/mol. IUPAC name: naphtho[2,3-b][1]benzofuran-1-ylboronic acid. InChIKey: GUPYETLVSSDKRR-UHFFFAOYSA-N.
| Molecular formula | C16H11BO3 |
|---|---|
| Molecular weight | 262.1 g/mol |
| IUPAC name | naphtho[2,3-b][1]benzofuran-1-ylboronic acid |
| InChIKey | GUPYETLVSSDKRR-UHFFFAOYSA-N |
| SMILES | B(C1=C2C(=CC=C1)OC3=CC4=CC=CC=C4C=C32)(O)O |
Computed by PubChem (NCBI)