CAS 1627917-17-2 appears in our catalog under these names: naphtho(2,3–b)benzofuran–2–ylboronic acid, Naphtho[2,3-b]benzofuran-2-ylboronic acid, 97%, Naphtho[2,3-b]benzofuran-2-ylboronic acid, 97%, 97%. Offered by: GLPBio, Fluorochem, Chemat. Available pack sizes: 1g, 5g, 250mg.
Naphtho[2,3-b][1]benzofuran-2-ylboronic acid (CAS 1627917-17-2) is a chemical compound with the molecular formula C16H11BO3 and a molecular weight of 262.1 g/mol. IUPAC name: naphtho[2,3-b][1]benzofuran-2-ylboronic acid. InChIKey: FGXHNQHUZOHBRS-UHFFFAOYSA-N.
| Molecular formula | C16H11BO3 |
|---|---|
| Molecular weight | 262.1 g/mol |
| IUPAC name | naphtho[2,3-b][1]benzofuran-2-ylboronic acid |
| InChIKey | FGXHNQHUZOHBRS-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)OC3=CC4=CC=CC=C4C=C32)(O)O |
Computed by PubChem (NCBI)