Products 1256628-06-4
CAS 1256628-06-4 appears in our catalog under these names: 5-(Chloromethyl)-3-(4,6-dimethylpyrimidin-2-yl)-1,3-oxazolidin-2-one, 95%, 5-(Chloromethyl)-3-(4,6-dimethylpyrimidin-2-yl)oxazolidin-2-one, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
5-(chloromethyl)-3-(4,6-dimethylpyrimidin-2-yl)-1,3-oxazolidin-2-one (CAS 1256628-06-4) is a chemical compound with the molecular formula C10H12ClN3O2 and a molecular weight of 241.67 g/mol. IUPAC name: 5-(chloromethyl)-3-(4,6-dimethylpyrimidin-2-yl)-1,3-oxazolidin-2-one. InChIKey: WANYDHPJNOXTDI-UHFFFAOYSA-N.
| Molecular formula | C10H12ClN3O2 |
|---|---|
| Molecular weight | 241.67 g/mol |
| IUPAC name | 5-(chloromethyl)-3-(4,6-dimethylpyrimidin-2-yl)-1,3-oxazolidin-2-one |
| InChIKey | WANYDHPJNOXTDI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=N1)N2CC(OC2=O)CCl)C |
Computed by PubChem (NCBI)