CAS 332023-12-8 appears in our catalog under these names: 1-(2-Chloro-6-nitrophenyl)piperazine, 96%, 1-(2-Chloro-6-nitrophenyl)piperazine, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 25g, 1g, 10g, 5g.
1-(2-chloro-6-nitrophenyl)piperazine (CAS 332023-12-8) is a chemical compound with the molecular formula C10H12ClN3O2 and a molecular weight of 241.67 g/mol. IUPAC name: 1-(2-chloro-6-nitrophenyl)piperazine. InChIKey: GKOXZZHKOZLHRQ-UHFFFAOYSA-N.
| Molecular formula | C10H12ClN3O2 |
|---|---|
| Molecular weight | 241.67 g/mol |
| IUPAC name | 1-(2-chloro-6-nitrophenyl)piperazine |
| InChIKey | GKOXZZHKOZLHRQ-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=C(C=CC=C2Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)