CAS 1306605-94-6 appears in our catalog under these names: 4-[(3-Methyl-1,2,4-oxadiazol-5-yl)methoxy]aniline hydrochloride, 95%, 4-((3-Methyl-1,2,4-oxadiazol-5-yl)methoxy)aniline hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 100mg.
4-[(3-methyl-1,2,4-oxadiazol-5-yl)methoxy]aniline;hydrochloride (CAS 1306605-94-6) is a chemical compound with the molecular formula C10H12ClN3O2 and a molecular weight of 241.67 g/mol. IUPAC name: 4-[(3-methyl-1,2,4-oxadiazol-5-yl)methoxy]aniline;hydrochloride. InChIKey: HBDKNANIWXJWJM-UHFFFAOYSA-N.
| Molecular formula | C10H12ClN3O2 |
|---|---|
| Molecular weight | 241.67 g/mol |
| IUPAC name | 4-[(3-methyl-1,2,4-oxadiazol-5-yl)methoxy]aniline;hydrochloride |
| InChIKey | HBDKNANIWXJWJM-UHFFFAOYSA-N |
| SMILES | CC1=NOC(=N1)COC2=CC=C(C=C2)N.Cl |
Computed by PubChem (NCBI)