CAS 125674-79-5 is the registry number for (3-tert-Butyl-4,5-dihydro-1,2-oxazol-5-yl)(methyl)phosphinic acid, 95%. Offered by: AmBeed. Available pack sizes: 1g.
(3-tert-butyl-4,5-dihydro-1,2-oxazol-5-yl)-methylphosphinic acid (CAS 125674-79-5) is a chemical compound with the molecular formula C8H16NO3P and a molecular weight of 205.19 g/mol. IUPAC name: (3-tert-butyl-4,5-dihydro-1,2-oxazol-5-yl)-methylphosphinic acid. InChIKey: GXUPUFYVANJJEN-UHFFFAOYSA-N.
| Molecular formula | C8H16NO3P |
|---|---|
| Molecular weight | 205.19 g/mol |
| IUPAC name | (3-tert-butyl-4,5-dihydro-1,2-oxazol-5-yl)-methylphosphinic acid |
| InChIKey | GXUPUFYVANJJEN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=NOC(C1)P(=O)(C)O |
Computed by PubChem (NCBI)