Products 2613382-57-1
CAS 2613382-57-1 is the registry number for 5-(Dimethylphosphoryl)piperidine-3-carboxylic acid, 95%. Offered by: Ambeed, BLDpharm. Available pack sizes: 250mg, 1g, 50mg, 100mg.
5-dimethylphosphorylpiperidine-3-carboxylic acid (CAS 2613382-57-1) is a chemical compound with the molecular formula C8H16NO3P and a molecular weight of 205.19 g/mol. IUPAC name: 5-dimethylphosphorylpiperidine-3-carboxylic acid. InChIKey: TZFWDMAWWQAENT-UHFFFAOYSA-N.
| Molecular formula | C8H16NO3P |
|---|---|
| Molecular weight | 205.19 g/mol |
| IUPAC name | 5-dimethylphosphorylpiperidine-3-carboxylic acid |
| InChIKey | TZFWDMAWWQAENT-UHFFFAOYSA-N |
| SMILES | CP(=O)(C)C1CC(CNC1)C(=O)O |
Computed by PubChem (NCBI)