CAS 2669742-74-7 is the registry number for Rel-methyl (2S,4S)-4-(dimethylphosphoryl)pyrrolidine-2-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (2S,4S)-4-dimethylphosphorylpyrrolidine-2-carboxylate (CAS 2669742-74-7) is a chemical compound with the molecular formula C8H16NO3P and a molecular weight of 205.19 g/mol. IUPAC name: methyl (2S,4S)-4-dimethylphosphorylpyrrolidine-2-carboxylate. InChIKey: OTDBYYBLSBBNMJ-BQBZGAKWSA-N.
| Molecular formula | C8H16NO3P |
|---|---|
| Molecular weight | 205.19 g/mol |
| IUPAC name | methyl (2S,4S)-4-dimethylphosphorylpyrrolidine-2-carboxylate |
| InChIKey | OTDBYYBLSBBNMJ-BQBZGAKWSA-N |
| SMILES | COC(=O)[C@@H]1C[C@@H](CN1)P(=O)(C)C |
Computed by PubChem (NCBI)