Products 1256786-21-6
CAS 1256786-21-6 is the registry number for 6-(2,2,2-Trifluoroethoxy)pyridine-2-carbonitrile. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
6-(2,2,2-trifluoroethoxy)pyridine-2-carbonitrile (CAS 1256786-21-6) is a chemical compound with the molecular formula C8H5F3N2O and a molecular weight of 202.13 g/mol. IUPAC name: 6-(2,2,2-trifluoroethoxy)pyridine-2-carbonitrile. InChIKey: GUIHIYMCDWUPED-UHFFFAOYSA-N.
| Molecular formula | C8H5F3N2O |
|---|---|
| Molecular weight | 202.13 g/mol |
| IUPAC name | 6-(2,2,2-trifluoroethoxy)pyridine-2-carbonitrile |
| InChIKey | GUIHIYMCDWUPED-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1)OCC(F)(F)F)C#N |
Computed by PubChem (NCBI)