Products 1256786-51-2
CAS 1256786-51-2 is the registry number for 7-(Trifluoromethyl)-2,3-dihydro-1,8-naphthyridin-4(1H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-(trifluoromethyl)-2,3-dihydro-1H-1,8-naphthyridin-4-one (CAS 1256786-51-2) is a chemical compound with the molecular formula C9H7F3N2O and a molecular weight of 216.16 g/mol. IUPAC name: 7-(trifluoromethyl)-2,3-dihydro-1H-1,8-naphthyridin-4-one. InChIKey: QQRJYNYRQNFJOH-UHFFFAOYSA-N.
| Molecular formula | C9H7F3N2O |
|---|---|
| Molecular weight | 216.16 g/mol |
| IUPAC name | 7-(trifluoromethyl)-2,3-dihydro-1H-1,8-naphthyridin-4-one |
| InChIKey | QQRJYNYRQNFJOH-UHFFFAOYSA-N |
| SMILES | C1CNC2=C(C1=O)C=CC(=N2)C(F)(F)F |
Computed by PubChem (NCBI)