Products 1256809-93-4
CAS 1256809-93-4 is the registry number for 5-Hydroxy-6-(trifluoromethyl)picolinic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg.
5-hydroxy-6-(trifluoromethyl)pyridine-2-carboxylic acid (CAS 1256809-93-4) is a chemical compound with the molecular formula C7H4F3NO3 and a molecular weight of 207.11 g/mol. IUPAC name: 5-hydroxy-6-(trifluoromethyl)pyridine-2-carboxylic acid. InChIKey: GOYBEPZSDYTKNF-UHFFFAOYSA-N.
| Molecular formula | C7H4F3NO3 |
|---|---|
| Molecular weight | 207.11 g/mol |
| IUPAC name | 5-hydroxy-6-(trifluoromethyl)pyridine-2-carboxylic acid |
| InChIKey | GOYBEPZSDYTKNF-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1O)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)