Products 1256810-33-9

CAS 1256810-33-9 is the registry number for 2-Bromo-3-methoxyisonicotinic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

2-bromo-3-methoxypyridine-4-carboxylic acid (CAS 1256810-33-9) is a chemical compound with the molecular formula C7H6BrNO3 and a molecular weight of 232.03 g/mol. IUPAC name: 2-bromo-3-methoxypyridine-4-carboxylic acid. InChIKey: REOOSBWNNDBPLX-UHFFFAOYSA-N.

Identity
Molecular formulaC7H6BrNO3
Molecular weight232.03 g/mol
IUPAC name2-bromo-3-methoxypyridine-4-carboxylic acid
InChIKeyREOOSBWNNDBPLX-UHFFFAOYSA-N
SMILESCOC1=C(C=CN=C1Br)C(=O)O

Computed by PubChem (NCBI)