Products 1256819-55-2

CAS 1256819-55-2 is the registry number for Methyl 4-bromo-3-hydroxypyridine-2-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Methyl 4-bromo-3-hydroxypyridine-2-carboxylate (CAS 1256819-55-2) is a chemical compound with the molecular formula C7H6BrNO3 and a molecular weight of 232.03 g/mol. IUPAC name: methyl 4-bromo-3-hydroxypyridine-2-carboxylate. InChIKey: MBQNMLIBPKTDMP-UHFFFAOYSA-N.

Identity
Molecular formulaC7H6BrNO3
Molecular weight232.03 g/mol
IUPAC namemethyl 4-bromo-3-hydroxypyridine-2-carboxylate
InChIKeyMBQNMLIBPKTDMP-UHFFFAOYSA-N
SMILESCOC(=O)C1=NC=CC(=C1O)Br

Computed by PubChem (NCBI)