CAS 1256821-65-4 is the registry number for 1-(6-Bromo-5-methoxypyridin-3-yl)ethan-1-one, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g, 250mg.
1-(6-bromo-5-methoxy-3-pyridinyl)ethanone (CAS 1256821-65-4) is a chemical compound with the molecular formula C8H8BrNO2 and a molecular weight of 230.06 g/mol. IUPAC name: 1-(6-bromo-5-methoxy-3-pyridinyl)ethanone. InChIKey: MUKXQNXTSBDSBW-UHFFFAOYSA-N.
| Molecular formula | C8H8BrNO2 |
|---|---|
| Molecular weight | 230.06 g/mol |
| IUPAC name | 1-(6-bromo-5-methoxy-3-pyridinyl)ethanone |
| InChIKey | MUKXQNXTSBDSBW-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=C(N=C1)Br)OC |
Computed by PubChem (NCBI)