Products 1256834-22-6
CAS 1256834-22-6 is the registry number for 4-Chloro-7-(trifluoromethyl)pyrido[3,2-d]pyrimidine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
4-chloro-7-(trifluoromethyl)pyrido[3,2-d]pyrimidine (CAS 1256834-22-6) is a chemical compound with the molecular formula C8H3ClF3N3 and a molecular weight of 233.58 g/mol. IUPAC name: 4-chloro-7-(trifluoromethyl)pyrido[3,2-d]pyrimidine. InChIKey: ZNMRQSOIKVOCBL-UHFFFAOYSA-N.
| Molecular formula | C8H3ClF3N3 |
|---|---|
| Molecular weight | 233.58 g/mol |
| IUPAC name | 4-chloro-7-(trifluoromethyl)pyrido[3,2-d]pyrimidine |
| InChIKey | ZNMRQSOIKVOCBL-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC2=C1N=CN=C2Cl)C(F)(F)F |
Computed by PubChem (NCBI)