CAS 338739-98-3 appears in our catalog under these names: 4-Chloro-2-(trifluoromethyl)pyrido[2,3-d]pyrimidine, 95%, 4–Chloro–2–(trifluoromethyl)pyrido(2,3–d)pyrimidine, 4-Chloro-2-(trifluoromethyl),pyrido[2,3-d]pyrimidine, 95%, 95%, 4-Chloro-2-(trifluoromethyl)pyrido[2,3-d]pyrimidine, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 100mg, 1g.
4-chloro-2-(trifluoromethyl)pyrido[2,3-d]pyrimidine (CAS 338739-98-3) is a chemical compound with the molecular formula C8H3ClF3N3 and a molecular weight of 233.58 g/mol. IUPAC name: 4-chloro-2-(trifluoromethyl)pyrido[2,3-d]pyrimidine. InChIKey: NYCNVGUXVOGJSL-UHFFFAOYSA-N.
| Molecular formula | C8H3ClF3N3 |
|---|---|
| Molecular weight | 233.58 g/mol |
| IUPAC name | 4-chloro-2-(trifluoromethyl)pyrido[2,3-d]pyrimidine |
| InChIKey | NYCNVGUXVOGJSL-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(N=C1)N=C(N=C2Cl)C(F)(F)F |
Computed by PubChem (NCBI)