CAS 877402-73-8 is the registry number for 5-Chloro-3-(trifluoromethyl)pyrido[3,4-b]pyrazine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-chloro-3-(trifluoromethyl)pyrido[3,4-b]pyrazine (CAS 877402-73-8) is a chemical compound with the molecular formula C8H3ClF3N3 and a molecular weight of 233.58 g/mol. IUPAC name: 5-chloro-3-(trifluoromethyl)pyrido[3,4-b]pyrazine. InChIKey: GHFFDCUCNIMYMQ-UHFFFAOYSA-N.
| Molecular formula | C8H3ClF3N3 |
|---|---|
| Molecular weight | 233.58 g/mol |
| IUPAC name | 5-chloro-3-(trifluoromethyl)pyrido[3,4-b]pyrazine |
| InChIKey | GHFFDCUCNIMYMQ-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C2=NC(=CN=C21)C(F)(F)F)Cl |
Computed by PubChem (NCBI)