CAS 125710-05-6 appears in our catalog under these names: 7-Hydroxy-3,4,8-trimethyl-1,2-dihydroquinolin-2-one, 95%, 7-Hydroxy-3,4,8-trimethyl-1,2-dihydroquinolin-2-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
7-hydroxy-3,4,8-trimethyl-1H-quinolin-2-one (CAS 125710-05-6) is a chemical compound with the molecular formula C12H13NO2 and a molecular weight of 203.24 g/mol. IUPAC name: 7-hydroxy-3,4,8-trimethyl-1H-quinolin-2-one. InChIKey: UQMZZJHQNMPPRV-UHFFFAOYSA-N.
| Molecular formula | C12H13NO2 |
|---|---|
| Molecular weight | 203.24 g/mol |
| IUPAC name | 7-hydroxy-3,4,8-trimethyl-1H-quinolin-2-one |
| InChIKey | UQMZZJHQNMPPRV-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)NC2=C1C=CC(=C2C)O)C |
Computed by PubChem (NCBI)