Products 1257300-08-5

CAS 1257300-08-5 is the registry number for 4-(1,1-Difluoroethyl)piperidine hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 10g, 1g.

Structural formula: {0} (CAS {1})

4-(1,1-difluoroethyl)piperidine;hydrochloride (CAS 1257300-08-5) is a chemical compound with the molecular formula C7H14ClF2N and a molecular weight of 185.64 g/mol. IUPAC name: 4-(1,1-difluoroethyl)piperidine;hydrochloride. InChIKey: MBAOAXQMNRAELO-UHFFFAOYSA-N.

Identity
Molecular formulaC7H14ClF2N
Molecular weight185.64 g/mol
IUPAC name4-(1,1-difluoroethyl)piperidine;hydrochloride
InChIKeyMBAOAXQMNRAELO-UHFFFAOYSA-N
SMILESCC(C1CCNCC1)(F)F.Cl

Computed by PubChem (NCBI)