Products 1379025-24-7

CAS 1379025-24-7 appears in our catalog under these names: (3,3-Difluorocyclohexyl)methanamine hydrochloride, 95%, (3,3-Difluorocyclohexyl)methanamine hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 100mg, 250mg, 10g, 5g.

Structural formula: {0} (CAS {1})

(3,3-difluorocyclohexyl)methanamine;hydrochloride (CAS 1379025-24-7) is a chemical compound with the molecular formula C7H14ClF2N and a molecular weight of 185.64 g/mol. IUPAC name: (3,3-difluorocyclohexyl)methanamine;hydrochloride. InChIKey: VGYFFOOFGJJVQQ-UHFFFAOYSA-N.

Identity
Molecular formulaC7H14ClF2N
Molecular weight185.64 g/mol
IUPAC name(3,3-difluorocyclohexyl)methanamine;hydrochloride
InChIKeyVGYFFOOFGJJVQQ-UHFFFAOYSA-N
SMILESC1CC(CC(C1)(F)F)CN.Cl

Computed by PubChem (NCBI)